C18H19BrO4S — CID 14442101
2-[4-[4-(3-bromophenyl)sulfonylbutyl]phenyl]acetic acid (PubChem CID 14442101) has the molecular formula C18H19BrO4S and a molecular weight of 411.32 g/mol. Its IUPAC name is 2-[4-[4-(3-bromophenyl)sulfonylbutyl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-(3-bromophenyl)sulfonylbutyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 14442101 |
| Molecular Formula | C18H19BrO4S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 2-[4-[4-(3-bromophenyl)sulfonylbutyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CCCCS(=O)(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C18H19BrO4S/c19-16-5-3-6-17(13-16)24(22,23)11-2-1-4-14-7-9-15(10-8-14)12-18(20)21/h3,5-10,13H,1-2,4,11-12H2,(H,20,21) |
| InChIKey | FRNSEVCQUZZLIW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|