C32H32Br4O4S4 — CID 162134490
1-bromo-3-[4-(3-bromophenyl)sulfanylbutylsulfanyl]benzene;1-bromo-3-[4-(3-bromophenyl)sulfonylbutylsulfonyl]benzene (PubChem CID 162134490) has the molecular formula C32H32Br4O4S4 and a molecular weight of 928.49 g/mol. Its IUPAC name is 1-bromo-3-[4-(3-bromophenyl)sulfanylbutylsulfanyl]benzene;1-bromo-3-[4-(3-bromophenyl)sulfonylbutylsulfonyl]benzene.
| Compound Name | 1-bromo-3-[4-(3-bromophenyl)sulfanylbutylsulfanyl]benzene;1-bromo-3-[4-(3-bromophenyl)sulfonylbutylsulfonyl]benzene |
|---|---|
| PubChem CID | 162134490 |
| Molecular Formula | C32H32Br4O4S4 |
| Molecular Weight | 928.49 g/mol |
| Exact Mass | 923.79 |
| IUPAC Name | 1-bromo-3-[4-(3-bromophenyl)sulfanylbutylsulfanyl]benzene;1-bromo-3-[4-(3-bromophenyl)sulfonylbutylsulfonyl]benzene |
| SMILES | Brc1cccc(SCCCCSc2cccc(Br)c2)c1.O=S(=O)(CCCCS(=O)(=O)c1cccc(Br)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H16Br2O4S2.C16H16Br2S2/c17-13-5-3-7-15(11-13)23(19,20)9-1-2-10-24(21,22)16-8-4-6-14(18)12-16;17-13-5-3-7-15(11-13)19-9-1-2-10-20-16-8-4-6-14(18)12-16/h3-8,11-12H,1-2,9-10H2;3-8,11-12H,1-2,9-10H2 |
| InChIKey | ZJBZUCGJCVHECA-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.49 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|