C16H27NOS — CID 106714809
2,2-dimethyl-6-[(3-methylphenyl)methylsulfinyl]hexan-1-amine (PubChem CID 106714809) has the molecular formula C16H27NOS and a molecular weight of 281.46 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(3-methylphenyl)methylsulfinyl]hexan-1-amine.
| Compound Name | 2,2-dimethyl-6-[(3-methylphenyl)methylsulfinyl]hexan-1-amine |
|---|---|
| PubChem CID | 106714809 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2,2-dimethyl-6-[(3-methylphenyl)methylsulfinyl]hexan-1-amine |
| SMILES | Cc1cccc(CS(=O)CCCCC(C)(C)CN)c1 |
| InChI | InChI=1S/C16H27NOS/c1-14-7-6-8-15(11-14)12-19(18)10-5-4-9-16(2,3)13-17/h6-8,11H,4-5,9-10,12-13,17H2,1-3H3 |
| InChIKey | QPCMSDOJPOTSPF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|