C14H23NO2S — CID 64657427
N-(2-methoxyethyl)-3-[(3-methylphenyl)methylsulfinyl]propan-1-amine (PubChem CID 64657427) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(3-methylphenyl)methylsulfinyl]propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3-[(3-methylphenyl)methylsulfinyl]propan-1-amine |
|---|---|
| PubChem CID | 64657427 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(3-methylphenyl)methylsulfinyl]propan-1-amine |
| SMILES | COCCNCCCS(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C14H23NO2S/c1-13-5-3-6-14(11-13)12-18(16)10-4-7-15-8-9-17-2/h3,5-6,11,15H,4,7-10,12H2,1-2H3 |
| InChIKey | LHOWMDJCGIPHRB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|