C8H7ClF2O2S — CID 43345431
1-(2-chloroethylsulfonyl)-2,4-difluorobenzene (PubChem CID 43345431) has the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. Its IUPAC name is 1-(2-chloroethylsulfonyl)-2,4-difluorobenzene.
| Compound Name | 1-(2-chloroethylsulfonyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 43345431 |
| Molecular Formula | C8H7ClF2O2S |
| Molecular Weight | 240.66 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 1-(2-chloroethylsulfonyl)-2,4-difluorobenzene |
| SMILES | O=S(=O)(CCCl)c1ccc(F)cc1F |
| InChI | InChI=1S/C8H7ClF2O2S/c9-3-4-14(12,13)8-2-1-6(10)5-7(8)11/h1-2,5H,3-4H2 |
| InChIKey | KEHZOLZIGWGBKL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.66 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|