C12H15ClF2O2S — CID 62227813
2-(6-chlorohexylsulfonyl)-1,4-difluorobenzene (PubChem CID 62227813) has the molecular formula C12H15ClF2O2S and a molecular weight of 296.77 g/mol. Its IUPAC name is 2-(6-chlorohexylsulfonyl)-1,4-difluorobenzene.
| Compound Name | 2-(6-chlorohexylsulfonyl)-1,4-difluorobenzene |
|---|---|
| PubChem CID | 62227813 |
| Molecular Formula | C12H15ClF2O2S |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(6-chlorohexylsulfonyl)-1,4-difluorobenzene |
| SMILES | O=S(=O)(CCCCCCCl)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H15ClF2O2S/c13-7-3-1-2-4-8-18(16,17)12-9-10(14)5-6-11(12)15/h5-6,9H,1-4,7-8H2 |
| InChIKey | XNXMMFKIXBDRDE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|