C9H6BrF5O2S — CID 64757512
2-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,4-difluorobenzene (PubChem CID 64757512) has the molecular formula C9H6BrF5O2S and a molecular weight of 353.11 g/mol. Its IUPAC name is 2-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,4-difluorobenzene.
| Compound Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,4-difluorobenzene |
|---|---|
| PubChem CID | 64757512 |
| Molecular Formula | C9H6BrF5O2S |
| Molecular Weight | 353.11 g/mol |
| Exact Mass | 351.92 |
| IUPAC Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-1,4-difluorobenzene |
| SMILES | O=S(=O)(CC(Br)C(F)(F)F)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H6BrF5O2S/c10-8(9(13,14)15)4-18(16,17)7-3-5(11)1-2-6(7)12/h1-3,8H,4H2 |
| InChIKey | VUAMLZDTIMZLNY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|