C15H19BrF2O2S — CID 65005457
1-(bromomethyl)-1-[(2,5-difluorophenyl)sulfonylmethyl]cycloheptane (PubChem CID 65005457) has the molecular formula C15H19BrF2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is 1-(bromomethyl)-1-[(2,5-difluorophenyl)sulfonylmethyl]cycloheptane.
| Compound Name | 1-(bromomethyl)-1-[(2,5-difluorophenyl)sulfonylmethyl]cycloheptane |
|---|---|
| PubChem CID | 65005457 |
| Molecular Formula | C15H19BrF2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 1-(bromomethyl)-1-[(2,5-difluorophenyl)sulfonylmethyl]cycloheptane |
| SMILES | O=S(=O)(CC1(CBr)CCCCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H19BrF2O2S/c16-10-15(7-3-1-2-4-8-15)11-21(19,20)14-9-12(17)5-6-13(14)18/h5-6,9H,1-4,7-8,10-11H2 |
| InChIKey | LWOFABVPWKUGID-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|