C10H11BrF2O2S — CID 64995930
2-(3-bromo-2-methylpropyl)sulfonyl-1,4-difluorobenzene (PubChem CID 64995930) has the molecular formula C10H11BrF2O2S and a molecular weight of 313.16 g/mol. Its IUPAC name is 2-(3-bromo-2-methylpropyl)sulfonyl-1,4-difluorobenzene.
| Compound Name | 2-(3-bromo-2-methylpropyl)sulfonyl-1,4-difluorobenzene |
|---|---|
| PubChem CID | 64995930 |
| Molecular Formula | C10H11BrF2O2S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 2-(3-bromo-2-methylpropyl)sulfonyl-1,4-difluorobenzene |
| SMILES | CC(CBr)CS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H11BrF2O2S/c1-7(5-11)6-16(14,15)10-4-8(12)2-3-9(10)13/h2-4,7H,5-6H2,1H3 |
| InChIKey | XNWGEUBOWKRPGP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|