C11H16FNO2S — CID 117036265
3-(4-fluoro-2-methylphenyl)sulfonyl-2-methylpropan-1-amine (PubChem CID 117036265) has the molecular formula C11H16FNO2S and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-(4-fluoro-2-methylphenyl)sulfonyl-2-methylpropan-1-amine.
| Compound Name | 3-(4-fluoro-2-methylphenyl)sulfonyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 117036265 |
| Molecular Formula | C11H16FNO2S |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 3-(4-fluoro-2-methylphenyl)sulfonyl-2-methylpropan-1-amine |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)CC(C)CN |
| InChI | InChI=1S/C11H16FNO2S/c1-8(6-13)7-16(14,15)11-4-3-10(12)5-9(11)2/h3-5,8H,6-7,13H2,1-2H3 |
| InChIKey | IPFDJPUWSOHXMH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |