C14H21F2NO2S — CID 64673944
5-(2,5-difluorophenyl)sulfonyl-N-propylpentan-2-amine (PubChem CID 64673944) has the molecular formula C14H21F2NO2S and a molecular weight of 305.39 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)sulfonyl-N-propylpentan-2-amine.
| Compound Name | 5-(2,5-difluorophenyl)sulfonyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 64673944 |
| Molecular Formula | C14H21F2NO2S |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-(2,5-difluorophenyl)sulfonyl-N-propylpentan-2-amine |
| SMILES | CCCNC(C)CCCS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H21F2NO2S/c1-3-8-17-11(2)5-4-9-20(18,19)14-10-12(15)6-7-13(14)16/h6-7,10-11,17H,3-5,8-9H2,1-2H3 |
| InChIKey | OKCQZMBFMJQILO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |