About 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine
5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine (PubChem CID 64645664) has the molecular formula C14H21F2NO2S
and a molecular weight of 305.39 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine.
Molecular Properties
| Compound Name | 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine |
| PubChem CID | 64645664 |
| Molecular Formula | C14H21F2NO2S |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine |
| SMILES | CCCNC(C)CCCS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H21F2NO2S/c1-3-8-17-11(2)5-4-9-20(18,19)12-6-7-13(15)14(16)10-12/h6-7,10-11,17H,3-5,8-9H2,1-2H3 |
| InChIKey | VBUICTBRMBVRKN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine?
The IUPAC name of 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine (CID 64645664) is 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine.
What is the SMILES notation for 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine?
The canonical SMILES for 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine is CCCNC(C)CCCS(=O)(=O)c1ccc(F)c(F)c1.
What is the InChIKey of 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine?
The InChIKey is VBUICTBRMBVRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F2NO2S/c1-3-8-17-11(2)5-4-9-20(18,19)12-6-7-13(15)14(16)10-12/h6-7,10-11,17H,3-5,8-9H2,1-2H3.
What are the key properties of 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine?
5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine has a molecular weight of 305.39 g/mol, XLogP of 2.91, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-difluorophenyl)sulfonyl-N-propylpentan-2-amine is sourced from PubChem (CID 64645664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).