C13H18FNO4S2 — CID 18083639
N-(1,1-dioxothiolan-3-yl)-4-fluoro-N-propylbenzenesulfonamide (PubChem CID 18083639) has the molecular formula C13H18FNO4S2 and a molecular weight of 335.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-fluoro-N-propylbenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-fluoro-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 18083639 |
| Molecular Formula | C13H18FNO4S2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-fluoro-N-propylbenzenesulfonamide |
| SMILES | CCCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO4S2/c1-2-8-15(12-7-9-20(16,17)10-12)21(18,19)13-5-3-11(14)4-6-13/h3-6,12H,2,7-10H2,1H3 |
| InChIKey | GHPFCVKKVOZLCI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |