C13H17NO4S2 — CID 65262937
2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfonylbutanenitrile (PubChem CID 65262937) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfonylbutanenitrile.
| Compound Name | 2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfonylbutanenitrile |
|---|---|
| PubChem CID | 65262937 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfonylbutanenitrile |
| SMILES | CC(C)(C#N)CCS(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H17NO4S2/c1-13(2,10-14)8-9-20(17,18)12-6-4-11(5-7-12)19(3,15)16/h4-7H,8-9H2,1-3H3 |
| InChIKey | LKDNZKNUVPOBHI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |