C13H18N2O3S — CID 81206552
4-(4-amino-2-methoxyphenyl)sulfonyl-2,2-dimethylbutanenitrile (PubChem CID 81206552) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-(4-amino-2-methoxyphenyl)sulfonyl-2,2-dimethylbutanenitrile.
| Compound Name | 4-(4-amino-2-methoxyphenyl)sulfonyl-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 81206552 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-(4-amino-2-methoxyphenyl)sulfonyl-2,2-dimethylbutanenitrile |
| SMILES | COc1cc(N)ccc1S(=O)(=O)CCC(C)(C)C#N |
| InChI | InChI=1S/C13H18N2O3S/c1-13(2,9-14)6-7-19(16,17)12-5-4-10(15)8-11(12)18-3/h4-5,8H,6-7,15H2,1-3H3 |
| InChIKey | NORGFYPUQXIZLV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|