C12H15ClN2O2S — CID 81201878
4-(5-amino-2-chlorophenyl)sulfonyl-2,2-dimethylbutanenitrile (PubChem CID 81201878) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is 4-(5-amino-2-chlorophenyl)sulfonyl-2,2-dimethylbutanenitrile.
| Compound Name | 4-(5-amino-2-chlorophenyl)sulfonyl-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 81201878 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-(5-amino-2-chlorophenyl)sulfonyl-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCS(=O)(=O)c1cc(N)ccc1Cl |
| InChI | InChI=1S/C12H15ClN2O2S/c1-12(2,8-14)5-6-18(16,17)11-7-9(15)3-4-10(11)13/h3-4,7H,5-6,15H2,1-2H3 |
| InChIKey | YLTFUQAAOJBQSF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|