C13H15Cl2NO2S — CID 65263232
5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylpentanenitrile (PubChem CID 65263232) has the molecular formula C13H15Cl2NO2S and a molecular weight of 320.24 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65263232 |
| Molecular Formula | C13H15Cl2NO2S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO2S/c1-13(2,9-16)6-3-7-19(17,18)12-8-10(14)4-5-11(12)15/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | MRWXEUBMYWZLFL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |