C11H12ClF3N2O2S — CID 106218648
3-(aminomethyl)-4-chloro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide (PubChem CID 106218648) has the molecular formula C11H12ClF3N2O2S and a molecular weight of 328.74 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106218648 |
| Molecular Formula | C11H12ClF3N2O2S |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NC2(C(F)(F)F)CC2)ccc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O2S/c12-9-2-1-8(5-7(9)6-16)20(18,19)17-10(3-4-10)11(13,14)15/h1-2,5,17H,3-4,6,16H2 |
| InChIKey | DGIPTFPADTYERH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |