C12H14ClF3N2O2S — CID 106218679
3-(aminomethyl)-5-chloro-2-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide (PubChem CID 106218679) has the molecular formula C12H14ClF3N2O2S and a molecular weight of 342.77 g/mol. Its IUPAC name is 3-(aminomethyl)-5-chloro-2-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-chloro-2-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106218679 |
| Molecular Formula | C12H14ClF3N2O2S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-(aminomethyl)-5-chloro-2-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
| SMILES | Cc1c(CN)cc(Cl)cc1S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H14ClF3N2O2S/c1-7-8(6-17)4-9(13)5-10(7)21(19,20)18-11(2-3-11)12(14,15)16/h4-5,18H,2-3,6,17H2,1H3 |
| InChIKey | BCAHMUJNKITUNL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |