C11H13ClF4N2O2S — CID 106295911
3-(aminomethyl)-5-chloro-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide (PubChem CID 106295911) has the molecular formula C11H13ClF4N2O2S and a molecular weight of 348.75 g/mol. Its IUPAC name is 3-(aminomethyl)-5-chloro-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-chloro-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106295911 |
| Molecular Formula | C11H13ClF4N2O2S |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-(aminomethyl)-5-chloro-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
| SMILES | Cc1c(CN)cc(Cl)cc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H13ClF4N2O2S/c1-6-7(4-17)2-8(12)3-9(6)21(19,20)18-5-11(15,16)10(13)14/h2-3,10,18H,4-5,17H2,1H3 |
| InChIKey | YGQSQPSTKXSSLF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|