C12H20ClN3O2S — CID 106032749
3-(aminomethyl)-5-chloro-N-[2-(dimethylamino)ethyl]-2-methylbenzenesulfonamide (PubChem CID 106032749) has the molecular formula C12H20ClN3O2S and a molecular weight of 305.83 g/mol. Its IUPAC name is 3-(aminomethyl)-5-chloro-N-[2-(dimethylamino)ethyl]-2-methylbenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-chloro-N-[2-(dimethylamino)ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106032749 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-(aminomethyl)-5-chloro-N-[2-(dimethylamino)ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(CN)cc(Cl)cc1S(=O)(=O)NCCN(C)C |
| InChI | InChI=1S/C12H20ClN3O2S/c1-9-10(8-14)6-11(13)7-12(9)19(17,18)15-4-5-16(2)3/h6-7,15H,4-5,8,14H2,1-3H3 |
| InChIKey | ASLWVHHQGAKGCG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |