C11H13F4NO3S — CID 106295786
3-(hydroxymethyl)-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide (PubChem CID 106295786) has the molecular formula C11H13F4NO3S and a molecular weight of 315.29 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide.
| Compound Name | 3-(hydroxymethyl)-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106295786 |
| Molecular Formula | C11H13F4NO3S |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-(hydroxymethyl)-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
| SMILES | Cc1c(CO)cccc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H13F4NO3S/c1-7-8(5-17)3-2-4-9(7)20(18,19)16-6-11(14,15)10(12)13/h2-4,10,16-17H,5-6H2,1H3 |
| InChIKey | SRGMVNMQDHMPIX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|