C12H13BrF3NO3S — CID 134361933
1-(4-bromo-3-methylphenyl)sulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 134361933) has the molecular formula C12H13BrF3NO3S and a molecular weight of 388.21 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)sulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | 1-(4-bromo-3-methylphenyl)sulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 134361933 |
| Molecular Formula | C12H13BrF3NO3S |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)sulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(O)(C(F)(F)F)C2)ccc1Br |
| InChI | InChI=1S/C12H13BrF3NO3S/c1-8-6-9(2-3-10(8)13)21(19,20)17-5-4-11(18,7-17)12(14,15)16/h2-3,6,18H,4-5,7H2,1H3 |
| InChIKey | PFJRNMPQTOBGQN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |