C12H14ClF3N2O3S — CID 71906767
1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-4-(trifluoromethyl)piperidin-4-ol (PubChem CID 71906767) has the molecular formula C12H14ClF3N2O3S and a molecular weight of 358.77 g/mol. Its IUPAC name is 1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-4-(trifluoromethyl)piperidin-4-ol.
| Compound Name | 1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-4-(trifluoromethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 71906767 |
| Molecular Formula | C12H14ClF3N2O3S |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1-[(6-chloro-5-methyl-3-pyridinyl)sulfonyl]-4-(trifluoromethyl)piperidin-4-ol |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(O)(C(F)(F)F)CC2)cnc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O3S/c1-8-6-9(7-17-10(8)13)22(20,21)18-4-2-11(19,3-5-18)12(14,15)16/h6-7,19H,2-5H2,1H3 |
| InChIKey | WPMIPZAAJBQSBB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|