C11H14Cl2N2O3S — CID 64607202
4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2-dimethylmorpholine (PubChem CID 64607202) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2-dimethylmorpholine.
| Compound Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 64607202 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)c2cnc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-11(2)7-15(3-4-18-11)19(16,17)8-5-9(12)10(13)14-6-8/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | QGGCFJOWLTVTCH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|