C13H15N3O2S — CID 64852272
5-amino-N-(2-methylbut-3-yn-2-yl)-1H-indole-3-sulfonamide (PubChem CID 64852272) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 5-amino-N-(2-methylbut-3-yn-2-yl)-1H-indole-3-sulfonamide.
| Compound Name | 5-amino-N-(2-methylbut-3-yn-2-yl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 64852272 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 5-amino-N-(2-methylbut-3-yn-2-yl)-1H-indole-3-sulfonamide |
| SMILES | C#CC(C)(C)NS(=O)(=O)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C13H15N3O2S/c1-4-13(2,3)16-19(17,18)12-8-15-11-6-5-9(14)7-10(11)12/h1,5-8,15-16H,14H2,2-3H3 |
| InChIKey | NLEPYKLAVMUTFQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|