C12H13N5O2S — CID 64851493
5-amino-N-(5-methyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide (PubChem CID 64851493) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 5-amino-N-(5-methyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide.
| Compound Name | 5-amino-N-(5-methyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 64851493 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-amino-N-(5-methyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2c[nH]c3ccc(N)cc23)n[nH]1 |
| InChI | InChI=1S/C12H13N5O2S/c1-7-4-12(16-15-7)17-20(18,19)11-6-14-10-3-2-8(13)5-9(10)11/h2-6,14H,13H2,1H3,(H2,15,16,17) |
| InChIKey | WIZAHJWABWDKAI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|