About 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide
5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide (PubChem CID 64851285) has the molecular formula C12H12N4O3S
and a molecular weight of 292.32 g/mol. Its IUPAC name is 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide |
| PubChem CID | 64851285 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2c[nH]c3ccc(N)cc23)on1 |
| InChI | InChI=1S/C12H12N4O3S/c1-7-4-12(19-15-7)16-20(17,18)11-6-14-10-3-2-8(13)5-9(10)11/h2-6,14,16H,13H2,1H3 |
| InChIKey | QSINBJMOUKVJFH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide?
The IUPAC name of 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide (CID 64851285) is 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide.
What is the SMILES notation for 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide?
The canonical SMILES for 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide is Cc1cc(NS(=O)(=O)c2c[nH]c3ccc(N)cc23)on1.
What is the InChIKey of 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide?
The InChIKey is QSINBJMOUKVJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O3S/c1-7-4-12(19-15-7)16-20(17,18)11-6-14-10-3-2-8(13)5-9(10)11/h2-6,14,16H,13H2,1H3.
What are the key properties of 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide?
5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide has a molecular weight of 292.32 g/mol, XLogP of 1.85, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide is sourced from PubChem (CID 64851285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).