C12H12N4O3S — CID 64851285
5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide (PubChem CID 64851285) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide.
| Compound Name | 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 64851285 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2c[nH]c3ccc(N)cc23)on1 |
| InChI | InChI=1S/C12H12N4O3S/c1-7-4-12(19-15-7)16-20(17,18)11-6-14-10-3-2-8(13)5-9(10)11/h2-6,14,16H,13H2,1H3 |
| InChIKey | QSINBJMOUKVJFH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|