C11H13N3O5S2 — CID 62162311
2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide (PubChem CID 62162311) has the molecular formula C11H13N3O5S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 62162311 |
| Molecular Formula | C11H13N3O5S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(S(C)(=O)=O)ccc2N)on1 |
| InChI | InChI=1S/C11H13N3O5S2/c1-7-5-11(19-13-7)14-21(17,18)10-6-8(20(2,15)16)3-4-9(10)12/h3-6,14H,12H2,1-2H3 |
| InChIKey | QSWZUAUGVWREDH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|