About 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide
2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide (PubChem CID 62162311) has the molecular formula C11H13N3O5S2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide |
| PubChem CID | 62162311 |
| Molecular Formula | C11H13N3O5S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(S(C)(=O)=O)ccc2N)on1 |
| InChI | InChI=1S/C11H13N3O5S2/c1-7-5-11(19-13-7)14-21(17,18)10-6-8(20(2,15)16)3-4-9(10)12/h3-6,14H,12H2,1-2H3 |
| InChIKey | QSWZUAUGVWREDH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide?
The IUPAC name of 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide (CID 62162311) is 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide.
What is the SMILES notation for 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide?
The canonical SMILES for 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide is Cc1cc(NS(=O)(=O)c2cc(S(C)(=O)=O)ccc2N)on1.
What is the InChIKey of 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide?
The InChIKey is QSWZUAUGVWREDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O5S2/c1-7-5-11(19-13-7)14-21(17,18)10-6-8(20(2,15)16)3-4-9(10)12/h3-6,14H,12H2,1-2H3.
What are the key properties of 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide?
2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide has a molecular weight of 331.38 g/mol, XLogP of 0.77, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(3-methyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzenesulfonamide is sourced from PubChem (CID 62162311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).