C10H15N3O4S3 — CID 80746377
5-amino-N-[(2-methylthiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 80746377) has the molecular formula C10H15N3O4S3 and a molecular weight of 337.45 g/mol. Its IUPAC name is 5-amino-N-[(2-methylthiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-[(2-methylthiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80746377 |
| Molecular Formula | C10H15N3O4S3 |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 5-amino-N-[(2-methylthiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)CCCS1 |
| InChI | InChI=1S/C10H15N3O4S3/c1-10(3-2-4-18-10)6-12-20(16,17)8-5-7(13(14)15)9(11)19-8/h5,12H,2-4,6,11H2,1H3 |
| InChIKey | BOJRJIFHEMXROI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|