C12H17N3O4S2 — CID 80727843
5-amino-N-(2,2-dicyclopropylethyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80727843) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-amino-N-(2,2-dicyclopropylethyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-(2,2-dicyclopropylethyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80727843 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 5-amino-N-(2,2-dicyclopropylethyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)NCC(C2CC2)C2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O4S2/c13-12-10(15(16)17)5-11(20-12)21(18,19)14-6-9(7-1-2-7)8-3-4-8/h5,7-9,14H,1-4,6,13H2 |
| InChIKey | GBWXKHNIACFWJD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|