C11H12Br2N2O2S — CID 106219913
4-amino-2,6-dibromo-N-pent-4-ynylbenzenesulfonamide (PubChem CID 106219913) has the molecular formula C11H12Br2N2O2S and a molecular weight of 396.10 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-pent-4-ynylbenzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-pent-4-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 106219913 |
| Molecular Formula | C11H12Br2N2O2S |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | 4-amino-2,6-dibromo-N-pent-4-ynylbenzenesulfonamide |
| SMILES | C#CCCCNS(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C11H12Br2N2O2S/c1-2-3-4-5-15-18(16,17)11-9(12)6-8(14)7-10(11)13/h1,6-7,15H,3-5,14H2 |
| InChIKey | HIDQUIIPDFYCBB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|