C9H9Br2NO4S — CID 43404988
methyl 2-[(2,5-dibromophenyl)sulfonylamino]acetate (PubChem CID 43404988) has the molecular formula C9H9Br2NO4S and a molecular weight of 387.05 g/mol. Its IUPAC name is methyl 2-[(2,5-dibromophenyl)sulfonylamino]acetate.
| Compound Name | methyl 2-[(2,5-dibromophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 43404988 |
| Molecular Formula | C9H9Br2NO4S |
| Molecular Weight | 387.05 g/mol |
| Exact Mass | 384.86 |
| IUPAC Name | methyl 2-[(2,5-dibromophenyl)sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C9H9Br2NO4S/c1-16-9(13)5-12-17(14,15)8-4-6(10)2-3-7(8)11/h2-4,12H,5H2,1H3 |
| InChIKey | BJHRWHPDCQJRNY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.05 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |