C8H9Br2NO3S — CID 60700593
2,5-dibromo-N-ethoxybenzenesulfonamide (PubChem CID 60700593) has the molecular formula C8H9Br2NO3S and a molecular weight of 359.04 g/mol. Its IUPAC name is 2,5-dibromo-N-ethoxybenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 60700593 |
| Molecular Formula | C8H9Br2NO3S |
| Molecular Weight | 359.04 g/mol |
| Exact Mass | 356.87 |
| IUPAC Name | 2,5-dibromo-N-ethoxybenzenesulfonamide |
| SMILES | CCONS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C8H9Br2NO3S/c1-2-14-11-15(12,13)8-5-6(9)3-4-7(8)10/h3-5,11H,2H2,1H3 |
| InChIKey | CBLUPSFSCUZCPP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.04 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|