C12H12BrFN2O2S2 — CID 102920830
2-(aminomethyl)-N-[(4-bromothiophen-2-yl)methyl]-5-fluorobenzenesulfonamide (PubChem CID 102920830) has the molecular formula C12H12BrFN2O2S2 and a molecular weight of 379.28 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(4-bromothiophen-2-yl)methyl]-5-fluorobenzenesulfonamide.
| Compound Name | 2-(aminomethyl)-N-[(4-bromothiophen-2-yl)methyl]-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 102920830 |
| Molecular Formula | C12H12BrFN2O2S2 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 2-(aminomethyl)-N-[(4-bromothiophen-2-yl)methyl]-5-fluorobenzenesulfonamide |
| SMILES | NCc1ccc(F)cc1S(=O)(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H12BrFN2O2S2/c13-9-3-11(19-7-9)6-16-20(17,18)12-4-10(14)2-1-8(12)5-15/h1-4,7,16H,5-6,15H2 |
| InChIKey | MRMKVEKKKVYABA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |