C13H11Br2FN2O2S — CID 106088872
2-(aminomethyl)-N-(2,6-dibromophenyl)-5-fluorobenzenesulfonamide (PubChem CID 106088872) has the molecular formula C13H11Br2FN2O2S and a molecular weight of 438.12 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2,6-dibromophenyl)-5-fluorobenzenesulfonamide.
| Compound Name | 2-(aminomethyl)-N-(2,6-dibromophenyl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106088872 |
| Molecular Formula | C13H11Br2FN2O2S |
| Molecular Weight | 438.12 g/mol |
| Exact Mass | 435.89 |
| IUPAC Name | 2-(aminomethyl)-N-(2,6-dibromophenyl)-5-fluorobenzenesulfonamide |
| SMILES | NCc1ccc(F)cc1S(=O)(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C13H11Br2FN2O2S/c14-10-2-1-3-11(15)13(10)18-21(19,20)12-6-9(16)5-4-8(12)7-17/h1-6,18H,7,17H2 |
| InChIKey | GRAMBTFZESHIKL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |