C13H14BrNO4S2 — CID 102704070
N-[(4-bromothiophen-2-yl)methyl]-4-(hydroxymethyl)-2-methoxybenzenesulfonamide (PubChem CID 102704070) has the molecular formula C13H14BrNO4S2 and a molecular weight of 392.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-(hydroxymethyl)-2-methoxybenzenesulfonamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-(hydroxymethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 102704070 |
| Molecular Formula | C13H14BrNO4S2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 390.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-(hydroxymethyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(CO)ccc1S(=O)(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H14BrNO4S2/c1-19-12-4-9(7-16)2-3-13(12)21(17,18)15-6-11-5-10(14)8-20-11/h2-5,8,15-16H,6-7H2,1H3 |
| InChIKey | ZZGHZZSCMHETTO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |