C12H12Br2N2OS — CID 106379927
4-[[1-(2,4-dibromophenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379927) has the molecular formula C12H12Br2N2OS and a molecular weight of 392.12 g/mol. Its IUPAC name is 4-[[1-(2,4-dibromophenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[1-(2,4-dibromophenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379927 |
| Molecular Formula | C12H12Br2N2OS |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 389.90 |
| IUPAC Name | 4-[[1-(2,4-dibromophenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(NCc1csc(=O)[nH]1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H12Br2N2OS/c1-7(10-3-2-8(13)4-11(10)14)15-5-9-6-18-12(17)16-9/h2-4,6-7,15H,5H2,1H3,(H,16,17) |
| InChIKey | ISSSCPMRVCABDG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |