C12H14N2O2S — CID 114181361
4-[[1-(2-hydroxyphenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181361) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyphenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[1-(2-hydroxyphenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 114181361 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-[[1-(2-hydroxyphenyl)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(NCc1csc(=O)[nH]1)c1ccccc1O |
| InChI | InChI=1S/C12H14N2O2S/c1-8(10-4-2-3-5-11(10)15)13-6-9-7-17-12(16)14-9/h2-5,7-8,13,15H,6H2,1H3,(H,14,16) |
| InChIKey | VNHALAUKYUYDJF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|