About 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one
4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380378) has the molecular formula C9H11N3OS2
and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 106380378 |
| Molecular Formula | C9H11N3OS2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(NCc1csc(=O)[nH]1)c1nccs1 |
| InChI | InChI=1S/C9H11N3OS2/c1-6(8-10-2-3-14-8)11-4-7-5-15-9(13)12-7/h2-3,5-6,11H,4H2,1H3,(H,12,13) |
| InChIKey | KHWKUSKXZZIHQB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one (CID 106380378) is 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one is CC(NCc1csc(=O)[nH]1)c1nccs1.
What is the InChIKey of 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one?
The InChIKey is KHWKUSKXZZIHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS2/c1-6(8-10-2-3-14-8)11-4-7-5-15-9(13)12-7/h2-3,5-6,11H,4H2,1H3,(H,12,13).
What are the key properties of 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one?
4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one has a molecular weight of 241.34 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 106380378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).