C11H9FN2O5S2 — CID 106379581
2-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]benzoic acid (PubChem CID 106379581) has the molecular formula C11H9FN2O5S2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]benzoic acid.
| Compound Name | 2-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106379581 |
| Molecular Formula | C11H9FN2O5S2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCc2csc(=O)[nH]2)ccc1F |
| InChI | InChI=1S/C11H9FN2O5S2/c12-9-2-1-7(3-8(9)10(15)16)21(18,19)13-4-6-5-20-11(17)14-6/h1-3,5,13H,4H2,(H,14,17)(H,15,16) |
| InChIKey | AAAUGWNIXHEHFV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |