C12H16FNO4S2 — CID 104654829
2-fluoro-5-[(2-methyl-2-methylsulfanylpropyl)sulfamoyl]benzoic acid (PubChem CID 104654829) has the molecular formula C12H16FNO4S2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-fluoro-5-[(2-methyl-2-methylsulfanylpropyl)sulfamoyl]benzoic acid.
| Compound Name | 2-fluoro-5-[(2-methyl-2-methylsulfanylpropyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 104654829 |
| Molecular Formula | C12H16FNO4S2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-fluoro-5-[(2-methyl-2-methylsulfanylpropyl)sulfamoyl]benzoic acid |
| SMILES | CSC(C)(C)CNS(=O)(=O)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H16FNO4S2/c1-12(2,19-3)7-14-20(17,18)8-4-5-10(13)9(6-8)11(15)16/h4-6,14H,7H2,1-3H3,(H,15,16) |
| InChIKey | PDNRMDNXCWXZBF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |