C13H11N5O2 — CID 61000500
8-nitro-N-(1H-pyrazol-4-ylmethyl)isoquinolin-5-amine (PubChem CID 61000500) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 8-nitro-N-(1H-pyrazol-4-ylmethyl)isoquinolin-5-amine.
| Compound Name | 8-nitro-N-(1H-pyrazol-4-ylmethyl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 61000500 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 8-nitro-N-(1H-pyrazol-4-ylmethyl)isoquinolin-5-amine |
| SMILES | O=[N+]([O-])c1ccc(NCc2cn[nH]c2)c2ccncc12 |
| InChI | InChI=1S/C13H11N5O2/c19-18(20)13-2-1-12(10-3-4-14-8-11(10)13)15-5-9-6-16-17-7-9/h1-4,6-8,15H,5H2,(H,16,17) |
| InChIKey | MNXDJHNWWGURPC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|