C18H19N5O3 — CID 133367444
3,4-diethyl-5-[[(8-nitroisoquinolin-5-yl)amino]methyl]-1H-pyridazin-6-one (PubChem CID 133367444) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3,4-diethyl-5-[[(8-nitroisoquinolin-5-yl)amino]methyl]-1H-pyridazin-6-one.
| Compound Name | 3,4-diethyl-5-[[(8-nitroisoquinolin-5-yl)amino]methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133367444 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3,4-diethyl-5-[[(8-nitroisoquinolin-5-yl)amino]methyl]-1H-pyridazin-6-one |
| SMILES | CCc1n[nH]c(=O)c(CNc2ccc([N+](=O)[O-])c3cnccc23)c1CC |
| InChI | InChI=1S/C18H19N5O3/c1-3-11-14(18(24)22-21-15(11)4-2)10-20-16-5-6-17(23(25)26)13-9-19-8-7-12(13)16/h5-9,20H,3-4,10H2,1-2H3,(H,22,24) |
| InChIKey | HZMAASHZVYBSCL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|