C13H15N3O3S — CID 63830447
3-ethoxy-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]aniline (PubChem CID 63830447) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-ethoxy-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]aniline.
| Compound Name | 3-ethoxy-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 63830447 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-ethoxy-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]aniline |
| SMILES | CCOc1cc(NCCc2cscn2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O3S/c1-2-19-13-7-10(3-4-12(13)16(17)18)14-6-5-11-8-20-9-15-11/h3-4,7-9,14H,2,5-6H2,1H3 |
| InChIKey | LGOOAGYVWPOHGM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|