C13H13IN2O3 — CID 104627877
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-4-iodobenzamide (PubChem CID 104627877) has the molecular formula C13H13IN2O3 and a molecular weight of 372.16 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-4-iodobenzamide.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 104627877 |
| Molecular Formula | C13H13IN2O3 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-hydroxy-4-iodobenzamide |
| SMILES | Cc1noc(C)c1CNC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C13H13IN2O3/c1-7-10(8(2)19-16-7)6-15-13(18)9-3-4-11(14)12(17)5-9/h3-5,17H,6H2,1-2H3,(H,15,18) |
| InChIKey | WXTBXBQRTCWYAH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|