C12H13ClN4O2 — CID 78918282
2-amino-6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridine-4-carboxamide (PubChem CID 78918282) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 78918282 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-amino-6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridine-4-carboxamide |
| SMILES | Cc1noc(C)c1CNC(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-6-9(7(2)19-17-6)5-15-12(18)8-3-10(13)16-11(14)4-8/h3-4H,5H2,1-2H3,(H2,14,16)(H,15,18) |
| InChIKey | RVHLUJYMYGSFEW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|