C16H21ClO4 — CID 91712632
1-O-[(4-chlorophenyl)methyl] 3-O-ethyl 2,2-diethylpropanedioate (PubChem CID 91712632) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is 1-O-[(4-chlorophenyl)methyl] 3-O-ethyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-[(4-chlorophenyl)methyl] 3-O-ethyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91712632 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-O-[(4-chlorophenyl)methyl] 3-O-ethyl 2,2-diethylpropanedioate |
| SMILES | CCOC(=O)C(CC)(CC)C(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21ClO4/c1-4-16(5-2,14(18)20-6-3)15(19)21-11-12-7-9-13(17)10-8-12/h7-10H,4-6,11H2,1-3H3 |
| InChIKey | GBYJIXOOZLRTES-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|