C17H22F2O4 — CID 91712898
1-O-[(3,4-difluorophenyl)methyl] 3-O-propyl 2,2-diethylpropanedioate (PubChem CID 91712898) has the molecular formula C17H22F2O4 and a molecular weight of 328.35 g/mol. Its IUPAC name is 1-O-[(3,4-difluorophenyl)methyl] 3-O-propyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-[(3,4-difluorophenyl)methyl] 3-O-propyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91712898 |
| Molecular Formula | C17H22F2O4 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-O-[(3,4-difluorophenyl)methyl] 3-O-propyl 2,2-diethylpropanedioate |
| SMILES | CCCOC(=O)C(CC)(CC)C(=O)OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H22F2O4/c1-4-9-22-15(20)17(5-2,6-3)16(21)23-11-12-7-8-13(18)14(19)10-12/h7-8,10H,4-6,9,11H2,1-3H3 |
| InChIKey | GRWXCDAWROEIEP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|