C21H20Br4O4 — CID 174973705
bis[(3,5-dibromophenyl)methyl] 2,2-diethylpropanedioate (PubChem CID 174973705) has the molecular formula C21H20Br4O4 and a molecular weight of 656.00 g/mol. Its IUPAC name is bis[(3,5-dibromophenyl)methyl] 2,2-diethylpropanedioate.
| Compound Name | bis[(3,5-dibromophenyl)methyl] 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 174973705 |
| Molecular Formula | C21H20Br4O4 |
| Molecular Weight | 656.00 g/mol |
| Exact Mass | 651.81 |
| IUPAC Name | bis[(3,5-dibromophenyl)methyl] 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OCc1cc(Br)cc(Br)c1)C(=O)OCc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C21H20Br4O4/c1-3-21(4-2,19(26)28-11-13-5-15(22)9-16(23)6-13)20(27)29-12-14-7-17(24)10-18(25)8-14/h5-10H,3-4,11-12H2,1-2H3 |
| InChIKey | KWERWCVRDCBPGP-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.00 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|